Multiple Assemblies exist for SMTL entry 7g04
Crystal Structure of human FABP5 in complex with 7-(4-chlorophenyl)-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid, i.e. SMILES c12c(ccc(c2)c2ccc(cc2)Cl)CCC[C@H]1C(=O)O with IC50=3.3 microM; X-RAY DIFFRACTION 1.40 Å

	SMTL ID 7g04.1 Ligands - Polypeptides Fatty acid-binding protein 5 Oligo-state monomer
	SMTL ID 7g04.2 Ligands DIMETHYL SULFOXIDE; SULFATE ION; CHLORIDE ION; (1R)-7-(4-chlorophenyl)-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid Polypeptides Fatty acid-binding protein 5 Oligo-state monomer